Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Mineral oil, for spectroscopy, suitable for nujol mull preparations for IR-spect.
CAS: 8042-47-5 Molecular Formula: C16H10N2Na2O7S2 Molecular Weight (g/mol): 452.363 MDL Number: MFCD00131611 InChI Key: AEOVEGJBKQQFOP-DDVLFWKVSA-L Synonym: acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g PubChem CID: 9566064 IUPAC Name: disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate SMILES: C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 9566064 |
|---|---|
| CAS | 8042-47-5 |
| Molecular Weight (g/mol) | 452.363 |
| MDL Number | MFCD00131611 |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | acid orange 10,wool orange 2g,orange g,c.i. acid orange 10,c.i. orange g,c.i. food orange 4,light orange g,colacid orange g,dolkwal orange g,hexacol orange g |
| IUPAC Name | disodium;(8Z)-7-oxo-8-(phenylhydrazinylidene)naphthalene-1,3-disulfonate |
| InChI Key | AEOVEGJBKQQFOP-DDVLFWKVSA-L |
| Molecular Formula | C16H10N2Na2O7S2 |
Vinyl acetate, 99+%, stabilized
CAS: 108-05-4 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 InChI Key: XTXRWKRVRITETP-UHFFFAOYSA-N Synonym: vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer PubChem CID: 7904 ChEBI: CHEBI:46916 IUPAC Name: ethenyl acetate SMILES: CC(=O)OC=C
| PubChem CID | 7904 |
|---|---|
| CAS | 108-05-4 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:46916 |
| SMILES | CC(=O)OC=C |
| Synonym | vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer |
| IUPAC Name | ethenyl acetate |
| InChI Key | XTXRWKRVRITETP-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
Thermo Scientific Chemicals Fluorescein diacetate, 97%, pure
CAS: 596-09-8 Molecular Formula: C24H16O7 Molecular Weight (g/mol): 416.39 MDL Number: MFCD00005062 InChI Key: CHADEQDQBURGHL-UHFFFAOYSA-N Synonym: fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate PubChem CID: 65047 IUPAC Name: (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate SMILES: CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3
| PubChem CID | 65047 |
|---|---|
| CAS | 596-09-8 |
| Molecular Weight (g/mol) | 416.39 |
| MDL Number | MFCD00005062 |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3 |
| Synonym | fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate |
| IUPAC Name | (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| InChI Key | CHADEQDQBURGHL-UHFFFAOYSA-N |
| Molecular Formula | C24H16O7 |
2-Methyl-2-butanol, 98%
CAS: 75-85-4 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00004478 InChI Key: MSXVEPNJUHWQHW-UHFFFAOYSA-N Synonym: 2-methyl-2-butanol,tert-amyl alcohol,amylene hydrate,tert-pentyl alcohol,tert-pentanol,t-amyl alcohol,2-butanol, 2-methyl,dimethylethylcarbinol,ethyldimethylcarbinol,tert-isoamyl alcohol PubChem CID: 6405 IUPAC Name: 2-methylbutan-2-ol SMILES: CCC(C)(C)O
| PubChem CID | 6405 |
|---|---|
| CAS | 75-85-4 |
| Molecular Weight (g/mol) | 88.15 |
| MDL Number | MFCD00004478 |
| SMILES | CCC(C)(C)O |
| Synonym | 2-methyl-2-butanol,tert-amyl alcohol,amylene hydrate,tert-pentyl alcohol,tert-pentanol,t-amyl alcohol,2-butanol, 2-methyl,dimethylethylcarbinol,ethyldimethylcarbinol,tert-isoamyl alcohol |
| IUPAC Name | 2-methylbutan-2-ol |
| InChI Key | MSXVEPNJUHWQHW-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
Thermo Scientific Chemicals Guanidine hydrochloride, 99+%
CAS: 50-01-1 Molecular Formula: CH6ClN3 Molecular Weight (g/mol): 95.53 MDL Number: MFCD00013026 InChI Key: PJJJBBJSCAKJQF-UHFFFAOYSA-N Synonym: guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride PubChem CID: 5742 ChEBI: CHEBI:32735 IUPAC Name: guanidine;hydrochloride SMILES: C(=N)(N)N.Cl
| PubChem CID | 5742 |
|---|---|
| CAS | 50-01-1 |
| Molecular Weight (g/mol) | 95.53 |
| ChEBI | CHEBI:32735 |
| MDL Number | MFCD00013026 |
| SMILES | C(=N)(N)N.Cl |
| Synonym | guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride |
| IUPAC Name | guanidine;hydrochloride |
| InChI Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN3 |
Propyl 4-hydroxybenzoate, 99+%
CAS: 94-13-3 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.2 MDL Number: MFCD00002354 InChI Key: QELSKZZBTMNZEB-UHFFFAOYSA-N Synonym: propylparaben,propyl paraben,4-hydroxybenzoic acid propyl ester,propyl p-hydroxybenzoate,nipasol,nipazol,propyl butex,betacide p,propyl parahydroxybenzoate,propylparasept PubChem CID: 7175 ChEBI: CHEBI:32063 IUPAC Name: propyl 4-hydroxybenzoate SMILES: CCCOC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7175 |
|---|---|
| CAS | 94-13-3 |
| Molecular Weight (g/mol) | 180.2 |
| ChEBI | CHEBI:32063 |
| MDL Number | MFCD00002354 |
| SMILES | CCCOC(=O)C1=CC=C(C=C1)O |
| Synonym | propylparaben,propyl paraben,4-hydroxybenzoic acid propyl ester,propyl p-hydroxybenzoate,nipasol,nipazol,propyl butex,betacide p,propyl parahydroxybenzoate,propylparasept |
| IUPAC Name | propyl 4-hydroxybenzoate |
| InChI Key | QELSKZZBTMNZEB-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
| CAS | 64742-47-8 |
|---|---|
| MDL Number | MFCD00135561 |
| Synonym | Kerosine |
2,3,5-Triphenyltetrazolium Chloride 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 298-96-4 Molecular Formula: C19H15ClN4 Molecular Weight (g/mol): 334.81 MDL Number: MFCD00011963 InChI Key: PKDBCJSWQUOKDO-UHFFFAOYSA-M Synonym: 2,3,5-triphenyltetrazolium chloride,tetrazolium red,uroscreen,red tetrazolium,urocheck,vitastain,tetrazolium chloride,triphenyltetrazolium chloride,2,3,5-triphenyl-2h-tetrazolium chloride,tetrazolium chloride PubChem CID: 9283 ChEBI: CHEBI:78019 IUPAC Name: triphenyl-3H-1,2λ⁵,3,4-tetrazol-2-ylium chloride SMILES: [Cl-].C1=CC=C(C=C1)N1N=C(N=[N+]1C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 9283 |
|---|---|
| CAS | 298-96-4 |
| Molecular Weight (g/mol) | 334.81 |
| ChEBI | CHEBI:78019 |
| MDL Number | MFCD00011963 |
| SMILES | [Cl-].C1=CC=C(C=C1)N1N=C(N=[N+]1C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2,3,5-triphenyltetrazolium chloride,tetrazolium red,uroscreen,red tetrazolium,urocheck,vitastain,tetrazolium chloride,triphenyltetrazolium chloride,2,3,5-triphenyl-2h-tetrazolium chloride,tetrazolium chloride |
| IUPAC Name | triphenyl-3H-1,2λ⁵,3,4-tetrazol-2-ylium chloride |
| InChI Key | PKDBCJSWQUOKDO-UHFFFAOYSA-M |
| Molecular Formula | C19H15ClN4 |
Urea, 99%, ACS reagent
CAS: 57-13-6 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
Benzophenone, 99%
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.222 MDL Number: MFCD00003076 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.222 |
| ChEBI | CHEBI:41308 |
| MDL Number | MFCD00003076 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
Guanidine Hydrochloride, >99.5%, Molecular Biology Grade
CAS: 50-01-1 Molecular Formula: CH6ClN3 Molecular Weight (g/mol): 95.53 MDL Number: MFCD00013026 InChI Key: PJJJBBJSCAKJQF-UHFFFAOYSA-N Synonym: guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride PubChem CID: 5742 ChEBI: CHEBI:32735
| PubChem CID | 5742 |
|---|---|
| CAS | 50-01-1 |
| Molecular Weight (g/mol) | 95.53 |
| ChEBI | CHEBI:32735 |
| MDL Number | MFCD00013026 |
| Synonym | guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride |
| InChI Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN3 |
(±)-2-Pentanol, 99%
CAS: 6032-29-7 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00004579 InChI Key: JYVLIDXNZAXMDK-UHFFFAOYSA-N Synonym: 2-pentanol,sec-amyl alcohol,methylpropylcarbinol,sec-pentyl alcohol,pentanol-2,methyl propyl carbinol,2-pentyl alcohol,2-hydroxypentane,1-methyl-1-butanol,alpha-methylbutanol PubChem CID: 22386 ChEBI: CHEBI:77518 IUPAC Name: pentan-2-ol SMILES: CCCC(C)O
| PubChem CID | 22386 |
|---|---|
| CAS | 6032-29-7 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:77518 |
| MDL Number | MFCD00004579 |
| SMILES | CCCC(C)O |
| Synonym | 2-pentanol,sec-amyl alcohol,methylpropylcarbinol,sec-pentyl alcohol,pentanol-2,methyl propyl carbinol,2-pentyl alcohol,2-hydroxypentane,1-methyl-1-butanol,alpha-methylbutanol |
| IUPAC Name | pentan-2-ol |
| InChI Key | JYVLIDXNZAXMDK-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
Resorcinol, ACS, 99.0-100.5%
CAS: 108-46-3 Molecular Formula: C6H6O2 Molecular Weight (g/mol): 110.112 MDL Number: MFCD00002269 InChI Key: GHMLBKRAJCXXBS-UHFFFAOYSA-N Synonym: resorcinol,1,3-benzenediol,resorcin,1,3-dihydroxybenzene,3-hydroxyphenol,m-hydroquinone,resorcine,m-dihydroxybenzene,m-hydroxyphenol,m-benzenediol PubChem CID: 5054 ChEBI: CHEBI:27810 IUPAC Name: benzene-1,3-diol SMILES: C1=CC(=CC(=C1)O)O
| PubChem CID | 5054 |
|---|---|
| CAS | 108-46-3 |
| Molecular Weight (g/mol) | 110.112 |
| ChEBI | CHEBI:27810 |
| MDL Number | MFCD00002269 |
| SMILES | C1=CC(=CC(=C1)O)O |
| Synonym | resorcinol,1,3-benzenediol,resorcin,1,3-dihydroxybenzene,3-hydroxyphenol,m-hydroquinone,resorcine,m-dihydroxybenzene,m-hydroxyphenol,m-benzenediol |
| IUPAC Name | benzene-1,3-diol |
| InChI Key | GHMLBKRAJCXXBS-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2 |
2-(2-Butoxyethoxy)ethanol, 99+%
CAS: 112-34-5 Molecular Formula: C8H18O3 Molecular Weight (g/mol): 162.23 InChI Key: OAYXUHPQHDHDDZ-UHFFFAOYSA-N Synonym: 2-2-butoxyethoxy ethanol,diethylene glycol monobutyl ether,butyldiglycol,butyl carbitol,diethylene glycol butyl ether,butyl diglycol,butyl digol,ethanol, 2-2-butoxyethoxy,butoxyethoxyethanol,butoxydiglycol PubChem CID: 8177 IUPAC Name: 2-(2-butoxyethoxy)ethanol SMILES: CCCCOCCOCCO
| PubChem CID | 8177 |
|---|---|
| CAS | 112-34-5 |
| Molecular Weight (g/mol) | 162.23 |
| SMILES | CCCCOCCOCCO |
| Synonym | 2-2-butoxyethoxy ethanol,diethylene glycol monobutyl ether,butyldiglycol,butyl carbitol,diethylene glycol butyl ether,butyl diglycol,butyl digol,ethanol, 2-2-butoxyethoxy,butoxyethoxyethanol,butoxydiglycol |
| IUPAC Name | 2-(2-butoxyethoxy)ethanol |
| InChI Key | OAYXUHPQHDHDDZ-UHFFFAOYSA-N |
| Molecular Formula | C8H18O3 |
Maleic anhydride, 99%, pastilles
CAS: 108-31-6 Molecular Formula: C4H2O3 Molecular Weight (g/mol): 98.06 MDL Number: MFCD00005518 InChI Key: FPYJFEHAWHCUMM-UHFFFAOYSA-N Synonym: maleic anhydride,2,5-furandione,maleic acid anhydride,toxilic anhydride,dihydro-2,5-dioxofuran,cis-butenedioic anhydride,2,5-dihydrofuran-2,5-dione,polymaleic anhydride,maleinanhydrid,rcra waste number u147 PubChem CID: 7923 ChEBI: CHEBI:474859 SMILES: O=C1OC(=O)C=C1
| PubChem CID | 7923 |
|---|---|
| CAS | 108-31-6 |
| Molecular Weight (g/mol) | 98.06 |
| ChEBI | CHEBI:474859 |
| MDL Number | MFCD00005518 |
| SMILES | O=C1OC(=O)C=C1 |
| Synonym | maleic anhydride,2,5-furandione,maleic acid anhydride,toxilic anhydride,dihydro-2,5-dioxofuran,cis-butenedioic anhydride,2,5-dihydrofuran-2,5-dione,polymaleic anhydride,maleinanhydrid,rcra waste number u147 |
| InChI Key | FPYJFEHAWHCUMM-UHFFFAOYSA-N |
| Molecular Formula | C4H2O3 |